About 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride
1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride (PubChem CID 70693472) has the molecular formula C17H19Cl3N2O
and a molecular weight of 373.71 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride |
| PubChem CID | 70693472 |
| Molecular Formula | C17H19Cl3N2O |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride |
| SMILES | Cl.Clc1cc(N2CCNCC2)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H18Cl2N2O.ClH/c18-15-10-14(21-8-6-20-7-9-21)11-16(19)17(15)22-12-13-4-2-1-3-5-13;/h1-5,10-11,20H,6-9,12H2;1H |
| InChIKey | REUZVBBHDTXGFP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride?
The IUPAC name of 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride (CID 70693472) is 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride.
What is the SMILES notation for 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride?
The canonical SMILES for 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride is Cl.Clc1cc(N2CCNCC2)cc(Cl)c1OCc1ccccc1.
What is the InChIKey of 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride?
The InChIKey is REUZVBBHDTXGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O.ClH/c18-15-10-14(21-8-6-20-7-9-21)11-16(19)17(15)22-12-13-4-2-1-3-5-13;/h1-5,10-11,20H,6-9,12H2;1H.
What are the key properties of 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride?
1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride has a molecular weight of 373.71 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichloro-4-phenylmethoxyphenyl)piperazine;hydrochloride is sourced from PubChem (CID 70693472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).