C21H27NO4 — CID 70693660
(2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]heptanamide (PubChem CID 70693660) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]heptanamide.
| Compound Name | (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]heptanamide |
|---|---|
| PubChem CID | 70693660 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]heptanamide |
| SMILES | CCCC[C@H](O)[C@](C)(OCc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C21H27NO4/c1-3-4-10-19(23)21(2,20(24)22-25)26-15-16-11-13-18(14-12-16)17-8-6-5-7-9-17/h5-9,11-14,19,23,25H,3-4,10,15H2,1-2H3,(H,22,24)/t19-,21-/m0/s1 |
| InChIKey | LPHYIYSLVMHHIT-FPOVZHCZSA-N |
| XLogP | 3.69 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|