C21H22N2O6 — CID 70693665
(2S,3S)-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide (PubChem CID 70693665) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2S,3S)-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide.
| Compound Name | (2S,3S)-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 70693665 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2S,3S)-N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide |
| SMILES | C[C@@](OCc1ccc(-c2ccccc2)cc1)(C(=O)NO)[C@@H](O)c1cc(CO)on1 |
| InChI | InChI=1S/C21H22N2O6/c1-21(20(26)22-27,19(25)18-11-17(12-24)29-23-18)28-13-14-7-9-16(10-8-14)15-5-3-2-4-6-15/h2-11,19,24-25,27H,12-13H2,1H3,(H,22,26)/t19-,21-/m0/s1 |
| InChIKey | YGXYUZQIGNWLTH-FPOVZHCZSA-N |
| XLogP | 2.35 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|