About 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole
4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole (PubChem CID 70693668) has the molecular formula C23H18N4OS
and a molecular weight of 398.49 g/mol. Its IUPAC name is 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole |
| PubChem CID | 70693668 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole |
| SMILES | c1ccc(Cn2ccc3c(Oc4ccc(Cc5cscn5)cc4)ncnc32)cc1 |
| InChI | InChI=1S/C23H18N4OS/c1-2-4-18(5-3-1)13-27-11-10-21-22(27)24-15-25-23(21)28-20-8-6-17(7-9-20)12-19-14-29-16-26-19/h1-11,14-16H,12-13H2 |
| InChIKey | BNKNRDNUYUKMPX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole?
The IUPAC name of 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole (CID 70693668) is 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole.
What is the SMILES notation for 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole?
The canonical SMILES for 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole is c1ccc(Cn2ccc3c(Oc4ccc(Cc5cscn5)cc4)ncnc32)cc1.
What is the InChIKey of 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole?
The InChIKey is BNKNRDNUYUKMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4OS/c1-2-4-18(5-3-1)13-27-11-10-21-22(27)24-15-25-23(21)28-20-8-6-17(7-9-20)12-19-14-29-16-26-19/h1-11,14-16H,12-13H2.
What are the key properties of 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole?
4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole has a molecular weight of 398.49 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(7-benzylpyrrolo[2,3-d]pyrimidin-4-yl)oxyphenyl]methyl]-1,3-thiazole is sourced from PubChem (CID 70693668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).