C26H31NO2 — CID 70693686
(3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-[5-(3-methylphenyl)-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 70693686) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-[5-(3-methylphenyl)-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-[5-(3-methylphenyl)-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 70693686 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-[5-(3-methylphenyl)-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CC[C@H]1[C@H](/C=C/c2ccc(-c3cccc(C)c3)cn2)[C@@H]2[C@@H](C)OC(=O)[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C26H31NO2/c1-5-22-17(3)14-24-25(18(4)29-26(24)28)23(22)12-11-21-10-9-20(15-27-21)19-8-6-7-16(2)13-19/h6-13,15,17-18,22-25H,5,14H2,1-4H3/b12-11+/t17-,18+,22+,23-,24+,25-/m0/s1 |
| InChIKey | LVDFAHKZJSYQQV-LPEXBXCHSA-N |
| XLogP | 5.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |