C16H20N6O6S2 — CID 70693755
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate (PubChem CID 70693755) has the molecular formula C16H20N6O6S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 70693755 |
| Molecular Formula | C16H20N6O6S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(NCCc4cccs4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H20N6O6S2/c17-30(25,26)27-6-10-12(23)13(24)16(28-10)22-8-21-11-14(19-7-20-15(11)22)18-4-3-9-2-1-5-29-9/h1-2,5,7-8,10,12-13,16,23-24H,3-4,6H2,(H2,17,25,26)(H,18,19,20)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | AAFPGBVHHSEHGR-XNIJJKJLSA-N |
| XLogP | -0.62 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |