About 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide
4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide (PubChem CID 70693779) has the molecular formula C14H12N6O3S
and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide.
Molecular Properties
| Compound Name | 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide |
| PubChem CID | 70693779 |
| Molecular Formula | C14H12N6O3S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)Nc2ccc(-n3cncn3)nc2)cc1 |
| InChI | InChI=1S/C14H12N6O3S/c15-24(22,23)12-4-1-10(2-5-12)14(21)19-11-3-6-13(17-7-11)20-9-16-8-18-20/h1-9H,(H,19,21)(H2,15,22,23) |
| InChIKey | ZGITYFPEAJEDQJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide?
The IUPAC name of 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide (CID 70693779) is 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide.
What is the SMILES notation for 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide?
The canonical SMILES for 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide is NS(=O)(=O)c1ccc(C(=O)Nc2ccc(-n3cncn3)nc2)cc1.
What is the InChIKey of 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide?
The InChIKey is ZGITYFPEAJEDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6O3S/c15-24(22,23)12-4-1-10(2-5-12)14(21)19-11-3-6-13(17-7-11)20-9-16-8-18-20/h1-9H,(H,19,21)(H2,15,22,23).
What are the key properties of 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide?
4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide has a molecular weight of 344.36 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfamoyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]benzamide is sourced from PubChem (CID 70693779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).