About 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium
10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium (PubChem CID 70693781) has the molecular formula C36H36F3NO2P+
and a molecular weight of 602.66 g/mol. Its IUPAC name is 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium.
Molecular Properties
| Compound Name | 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium |
| PubChem CID | 70693781 |
| Molecular Formula | C36H36F3NO2P+ |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCCC[P+](c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C36H36F3NO2P/c37-27-13-19-30(20-14-27)43(31-21-15-28(38)16-22-31,32-23-17-29(39)18-24-32)26-10-6-4-2-1-3-5-9-25-40-35(41)33-11-7-8-12-34(33)36(40)42/h7-8,11-24H,1-6,9-10,25-26H2/q+1 |
| InChIKey | UPXAXSGYORFMEQ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium?
The IUPAC name of 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium (CID 70693781) is 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium.
What is the SMILES notation for 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium?
The canonical SMILES for 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium is O=C1c2ccccc2C(=O)N1CCCCCCCCCC[P+](c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium?
The InChIKey is UPXAXSGYORFMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H36F3NO2P/c37-27-13-19-30(20-14-27)43(31-21-15-28(38)16-22-31,32-23-17-29(39)18-24-32)26-10-6-4-2-1-3-5-9-25-40-35(41)33-11-7-8-12-34(33)36(40)42/h7-8,11-24H,1-6,9-10,25-26H2/q+1.
What are the key properties of 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium?
10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium has a molecular weight of 602.66 g/mol, XLogP of 7.81, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-fluorophenyl)phosphanium is sourced from PubChem (CID 70693781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).