C36H31N2O5+ — CID 70694033
16-[3-[4-(1H-indol-2-yl)phenoxy]propoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 70694033) has the molecular formula C36H31N2O5+ and a molecular weight of 571.65 g/mol. Its IUPAC name is 16-[3-[4-(1H-indol-2-yl)phenoxy]propoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16-[3-[4-(1H-indol-2-yl)phenoxy]propoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 70694033 |
| Molecular Formula | C36H31N2O5+ |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 16-[3-[4-(1H-indol-2-yl)phenoxy]propoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCOc1ccc(-c2cc4ccccc4[nH]2)cc1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C36H31N2O5/c1-39-33-12-9-24-18-32-28-20-35-34(42-22-43-35)19-25(28)13-14-38(32)21-29(24)36(33)41-16-4-15-40-27-10-7-23(8-11-27)31-17-26-5-2-3-6-30(26)37-31/h2-3,5-12,17-21,37H,4,13-16,22H2,1H3/q+1 |
| InChIKey | PEVGGKJDMNPGDS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|