C25H15BrF6N6S — CID 70694067
N-[(E)-[2-(benzotriazol-1-yl)-1-(4-bromophenyl)ethylidene]amino]-4-[3,5-bis(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 70694067) has the molecular formula C25H15BrF6N6S and a molecular weight of 625.40 g/mol. Its IUPAC name is N-[(E)-[2-(benzotriazol-1-yl)-1-(4-bromophenyl)ethylidene]amino]-4-[3,5-bis(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[2-(benzotriazol-1-yl)-1-(4-bromophenyl)ethylidene]amino]-4-[3,5-bis(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 70694067 |
| Molecular Formula | C25H15BrF6N6S |
| Molecular Weight | 625.40 g/mol |
| Exact Mass | 624.02 |
| IUPAC Name | N-[(E)-[2-(benzotriazol-1-yl)-1-(4-bromophenyl)ethylidene]amino]-4-[3,5-bis(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)c1cc(-c2csc(N/N=C(/Cn3nnc4ccccc43)c3ccc(Br)cc3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H15BrF6N6S/c26-18-7-5-14(6-8-18)20(12-38-22-4-2-1-3-19(22)35-37-38)34-36-23-33-21(13-39-23)15-9-16(24(27,28)29)11-17(10-15)25(30,31)32/h1-11,13H,12H2,(H,33,36)/b34-20- |
| InChIKey | GWHVXDKGSAXGDO-GXBUFBABSA-N |
| XLogP | 7.87 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.40 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|