C24H27N5O — CID 70694146
1-[3-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]-3-pyridin-4-ylurea (PubChem CID 70694146) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[3-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[3-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 70694146 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[3-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]-3-pyridin-4-ylurea |
| SMILES | O=C(Nc1ccncc1)Nc1cccc(CCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H27N5O/c30-24(26-21-9-12-25-13-10-21)27-22-6-4-5-20(19-22)11-14-28-15-17-29(18-16-28)23-7-2-1-3-8-23/h1-10,12-13,19H,11,14-18H2,(H2,25,26,27,30) |
| InChIKey | NXQBRORDMXGPPG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |