C20H20N2O3 — CID 70694169
3-methyl-2-[4-(oxan-4-yloxy)phenyl]-1H-1,8-naphthyridin-4-one (PubChem CID 70694169) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-methyl-2-[4-(oxan-4-yloxy)phenyl]-1H-1,8-naphthyridin-4-one.
| Compound Name | 3-methyl-2-[4-(oxan-4-yloxy)phenyl]-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 70694169 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-methyl-2-[4-(oxan-4-yloxy)phenyl]-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1c(-c2ccc(OC3CCOCC3)cc2)[nH]c2ncccc2c1=O |
| InChI | InChI=1S/C20H20N2O3/c1-13-18(22-20-17(19(13)23)3-2-10-21-20)14-4-6-15(7-5-14)25-16-8-11-24-12-9-16/h2-7,10,16H,8-9,11-12H2,1H3,(H,21,22,23) |
| InChIKey | KZWQEZCLUSLPQH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |