C22H27N3O3 — CID 70694229
(1R,2R,5E,9S,17S)-5-[(3-nitrophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (PubChem CID 70694229) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (1R,2R,5E,9S,17S)-5-[(3-nitrophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one.
| Compound Name | (1R,2R,5E,9S,17S)-5-[(3-nitrophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
|---|---|
| PubChem CID | 70694229 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1R,2R,5E,9S,17S)-5-[(3-nitrophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES | O=C1/C(=C/c2cccc([N+](=O)[O-])c2)CC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C22H27N3O3/c26-22-16(12-15-4-1-6-18(13-15)25(27)28)8-9-20-19-7-3-11-23-10-2-5-17(21(19)23)14-24(20)22/h1,4,6,12-13,17,19-21H,2-3,5,7-11,14H2/b16-12+/t17-,19+,20+,21-/m0/s1 |
| InChIKey | OIFYUODREQGFRG-BAGUCIKASA-N |
| XLogP | 3.47 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|