C24H19NO3 — CID 70694292
2-[(4-methoxyphenyl)methylamino]-3-phenylnaphthalene-1,4-dione (PubChem CID 70694292) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylamino]-3-phenylnaphthalene-1,4-dione.
| Compound Name | 2-[(4-methoxyphenyl)methylamino]-3-phenylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 70694292 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylamino]-3-phenylnaphthalene-1,4-dione |
| SMILES | COc1ccc(CNC2=C(c3ccccc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H19NO3/c1-28-18-13-11-16(12-14-18)15-25-22-21(17-7-3-2-4-8-17)23(26)19-9-5-6-10-20(19)24(22)27/h2-14,25H,15H2,1H3 |
| InChIKey | DGWJJTNGZUQVMM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|