C22H27NO7S — CID 70694297
(1R,10S)-3,4,5,14-tetramethoxy-18-methylsulfonyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one (PubChem CID 70694297) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is (1R,10S)-3,4,5,14-tetramethoxy-18-methylsulfonyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one.
| Compound Name | (1R,10S)-3,4,5,14-tetramethoxy-18-methylsulfonyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one |
|---|---|
| PubChem CID | 70694297 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (1R,10S)-3,4,5,14-tetramethoxy-18-methylsulfonyl-18-azatetracyclo[8.5.3.01,11.02,7]octadeca-2,4,6,11,14-pentaen-13-one |
| SMILES | COC1=C[C@@]23CCN(S(C)(=O)=O)[C@@H](CCc4cc(OC)c(OC)c(OC)c42)C3=CC1=O |
| InChI | InChI=1S/C22H27NO7S/c1-27-17-10-13-6-7-15-14-11-16(24)18(28-2)12-22(14,8-9-23(15)31(5,25)26)19(13)21(30-4)20(17)29-3/h10-12,15H,6-9H2,1-5H3/t15-,22+/m0/s1 |
| InChIKey | OSVLEOKZCSAFCU-OYHNWAKOSA-N |
| XLogP | 1.97 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |