About 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide
2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 70694425) has the molecular formula C22H20N4OS
and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 70694425 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCNCC1)c1csc(C#Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H20N4OS/c27-22(19-16-28-21(24-19)11-10-17-6-2-1-3-7-17)25-18-8-4-5-9-20(18)26-14-12-23-13-15-26/h1-9,16,23H,12-15H2,(H,25,27) |
| InChIKey | LBGDSTFVJVZORQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (CID 70694425) is 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide is O=C(Nc1ccccc1N1CCNCC1)c1csc(C#Cc2ccccc2)n1.
What is the InChIKey of 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is LBGDSTFVJVZORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4OS/c27-22(19-16-28-21(24-19)11-10-17-6-2-1-3-7-17)25-18-8-4-5-9-20(18)26-14-12-23-13-15-26/h1-9,16,23H,12-15H2,(H,25,27).
What are the key properties of 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 388.50 g/mol, XLogP of 3.20, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethynyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 70694425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).