C22H28N2O4 — CID 70694575
(1R,9S,11S,18E)-8-acetyl-18-ethylidene-6-hydroxy-5-methoxy-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-trien-17-one (PubChem CID 70694575) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (1R,9S,11S,18E)-8-acetyl-18-ethylidene-6-hydroxy-5-methoxy-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-trien-17-one.
| Compound Name | (1R,9S,11S,18E)-8-acetyl-18-ethylidene-6-hydroxy-5-methoxy-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-trien-17-one |
|---|---|
| PubChem CID | 70694575 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (1R,9S,11S,18E)-8-acetyl-18-ethylidene-6-hydroxy-5-methoxy-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-trien-17-one |
| SMILES | C/C=C1/C(=O)[C@@]23CCN(C)CC[C@H]1C[C@@H]2N(C(C)=O)c1c3ccc(OC)c1O |
| InChI | InChI=1S/C22H28N2O4/c1-5-15-14-8-10-23(3)11-9-22(21(15)27)16-6-7-17(28-4)20(26)19(16)24(13(2)25)18(22)12-14/h5-7,14,18,26H,8-12H2,1-4H3/b15-5+/t14-,18-,22+/m0/s1 |
| InChIKey | HXWIJPIEAIUMKA-AUGJQDIFSA-N |
| XLogP | 2.63 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|