C20H33NO2 — CID 70694587
(5S,8R)-5-[(2S)-6-amino-5-hydroxy-6-methylheptan-2-yl]-3,8-dimethyl-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 70694587) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (5S,8R)-5-[(2S)-6-amino-5-hydroxy-6-methylheptan-2-yl]-3,8-dimethyl-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (5S,8R)-5-[(2S)-6-amino-5-hydroxy-6-methylheptan-2-yl]-3,8-dimethyl-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 70694587 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (5S,8R)-5-[(2S)-6-amino-5-hydroxy-6-methylheptan-2-yl]-3,8-dimethyl-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | Cc1cc(O)c2c(c1)[C@H]([C@@H](C)CCC(O)C(C)(C)N)CC[C@H]2C |
| InChI | InChI=1S/C20H33NO2/c1-12-10-16-15(8-6-14(3)19(16)17(22)11-12)13(2)7-9-18(23)20(4,5)21/h10-11,13-15,18,22-23H,6-9,21H2,1-5H3/t13-,14+,15-,18?/m0/s1 |
| InChIKey | MXWDPRUBCHXJLG-ITOLWWRJSA-N |
| XLogP | 4.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |