C27H35ClO — CID 70694589
(1S,4R)-5-[(4-chlorophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 70694589) has the molecular formula C27H35ClO and a molecular weight of 411.03 g/mol. Its IUPAC name is (1S,4R)-5-[(4-chlorophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,4R)-5-[(4-chlorophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 70694589 |
| Molecular Formula | C27H35ClO |
| Molecular Weight | 411.03 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | (1S,4R)-5-[(4-chlorophenyl)methoxy]-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)=CCC[C@H](C)[C@@H]1CC[C@@H](C)c2c(OCc3ccc(Cl)cc3)cc(C)cc21 |
| InChI | InChI=1S/C27H35ClO/c1-18(2)7-6-8-20(4)24-14-9-21(5)27-25(24)15-19(3)16-26(27)29-17-22-10-12-23(28)13-11-22/h7,10-13,15-16,20-21,24H,6,8-9,14,17H2,1-5H3/t20-,21+,24-/m0/s1 |
| InChIKey | JVACMWAIGDRMPN-IMSXRSKXSA-N |
| XLogP | 8.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.03 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|