C24H26Br2N2O4S2 — CID 70694593
2-[(3-bromo-4-hydroxyphenyl)methyl]-N-[2-[2-[2-[(3-bromo-4-hydroxyphenyl)methyl]prop-2-enoylamino]ethyldisulfanyl]ethyl]prop-2-enamide (PubChem CID 70694593) has the molecular formula C24H26Br2N2O4S2 and a molecular weight of 630.42 g/mol. Its IUPAC name is 2-[(3-bromo-4-hydroxyphenyl)methyl]-N-[2-[2-[2-[(3-bromo-4-hydroxyphenyl)methyl]prop-2-enoylamino]ethyldisulfanyl]ethyl]prop-2-enamide.
| Compound Name | 2-[(3-bromo-4-hydroxyphenyl)methyl]-N-[2-[2-[2-[(3-bromo-4-hydroxyphenyl)methyl]prop-2-enoylamino]ethyldisulfanyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 70694593 |
| Molecular Formula | C24H26Br2N2O4S2 |
| Molecular Weight | 630.42 g/mol |
| Exact Mass | 627.97 |
| IUPAC Name | 2-[(3-bromo-4-hydroxyphenyl)methyl]-N-[2-[2-[2-[(3-bromo-4-hydroxyphenyl)methyl]prop-2-enoylamino]ethyldisulfanyl]ethyl]prop-2-enamide |
| SMILES | C=C(Cc1ccc(O)c(Br)c1)C(=O)NCCSSCCNC(=O)C(=C)Cc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C24H26Br2N2O4S2/c1-15(11-17-3-5-21(29)19(25)13-17)23(31)27-7-9-33-34-10-8-28-24(32)16(2)12-18-4-6-22(30)20(26)14-18/h3-6,13-14,29-30H,1-2,7-12H2,(H,27,31)(H,28,32) |
| InChIKey | LEXQRXBHJSANAY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|