C28H48N2O4 — CID 70694613
methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[(3S)-3-methyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxypentyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 70694613) has the molecular formula C28H48N2O4 and a molecular weight of 476.70 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[(3S)-3-methyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxypentyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[(3S)-3-methyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxypentyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 70694613 |
| Molecular Formula | C28H48N2O4 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.36 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[(3S)-3-methyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxypentyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CC[C@H](C)CCOC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C28H48N2O4/c1-21(12-19-34-25(31)20-30-17-15-29(5)16-18-30)8-10-23-22(2)9-11-24-27(23,3)13-7-14-28(24,4)26(32)33-6/h21,23-24H,2,7-20H2,1,3-6H3/t21-,23-,24+,27+,28-/m0/s1 |
| InChIKey | NLFVUTPWEQFMNY-BOLGFTMLSA-N |
| XLogP | 4.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|