C23H18N4O7S — CID 70694745
2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 70694745) has the molecular formula C23H18N4O7S and a molecular weight of 494.49 g/mol. Its IUPAC name is 2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 70694745 |
| Molecular Formula | C23H18N4O7S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | COc1cc(-c2nnc(SCc3ccc([N+](=O)[O-])cc3)o2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18N4O7S/c1-32-21-12-17(6-11-20(21)33-13-15-2-7-18(8-3-15)26(28)29)22-24-25-23(34-22)35-14-16-4-9-19(10-5-16)27(30)31/h2-12H,13-14H2,1H3 |
| InChIKey | SRFRLBUFCPZIQY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 143.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|