C20H21NO4 — CID 70694930
(2S,3R,4S,5R)-2-(1-benzylindol-3-yl)oxane-3,4,5-triol (PubChem CID 70694930) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(1-benzylindol-3-yl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-(1-benzylindol-3-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70694930 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2S,3R,4S,5R)-2-(1-benzylindol-3-yl)oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2cn(Cc3ccccc3)c3ccccc23)OC[C@H]1O |
| InChI | InChI=1S/C20H21NO4/c22-17-12-25-20(19(24)18(17)23)15-11-21(10-13-6-2-1-3-7-13)16-9-5-4-8-14(15)16/h1-9,11,17-20,22-24H,10,12H2/t17-,18+,19-,20+/m1/s1 |
| InChIKey | HMOYCJJKDQYDQA-WCIQWLHISA-N |
| XLogP | 1.84 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |