About [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol
[4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol (PubChem CID 70694952) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol |
| PubChem CID | 70694952 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol |
| SMILES | CC1=C(C)[C@@](C)(c2ccc(CO)cc2)CC1 |
| InChI | InChI=1S/C15H20O/c1-11-8-9-15(3,12(11)2)14-6-4-13(10-16)5-7-14/h4-7,16H,8-10H2,1-3H3/t15-/m0/s1 |
| InChIKey | ASPJHNACYAXEJK-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol?
The IUPAC name of [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol (CID 70694952) is [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol.
What is the SMILES notation for [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol?
The canonical SMILES for [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol is CC1=C(C)[C@@](C)(c2ccc(CO)cc2)CC1.
What is the InChIKey of [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol?
The InChIKey is ASPJHNACYAXEJK-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H20O/c1-11-8-9-15(3,12(11)2)14-6-4-13(10-16)5-7-14/h4-7,16H,8-10H2,1-3H3/t15-/m0/s1.
What are the key properties of [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol?
[4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol has a molecular weight of 216.32 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1R)-1,2,3-trimethylcyclopent-2-en-1-yl]phenyl]methanol is sourced from PubChem (CID 70694952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).