C20H20F4N4O2 — CID 70695076
(3R)-3-amino-1-[4-(6-fluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70695076) has the molecular formula C20H20F4N4O2 and a molecular weight of 424.40 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(6-fluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(6-fluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70695076 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (3R)-3-amino-1-[4-(6-fluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2cccc(F)n2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H20F4N4O2/c21-14-11-16(23)15(22)9-12(14)8-13(25)10-19(29)27-4-6-28(7-5-27)20(30)17-2-1-3-18(24)26-17/h1-3,9,11,13H,4-8,10,25H2/t13-/m1/s1 |
| InChIKey | PPIGYAGFDCPTMR-CYBMUJFWSA-N |
| XLogP | 1.88 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|