About 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine
3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine (PubChem CID 70695440) has the molecular formula C26H21NO2
and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine |
| PubChem CID | 70695440 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine |
| SMILES | COc1ccc(C2=NC(c3ccc(C)cc3)c3c(ccc4ccccc34)O2)cc1 |
| InChI | InChI=1S/C26H21NO2/c1-17-7-9-19(10-8-17)25-24-22-6-4-3-5-18(22)13-16-23(24)29-26(27-25)20-11-14-21(28-2)15-12-20/h3-16,25H,1-2H3 |
| InChIKey | SBWDBOHSFHAECL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine?
The IUPAC name of 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine (CID 70695440) is 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine.
What is the SMILES notation for 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine?
The canonical SMILES for 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine is COc1ccc(C2=NC(c3ccc(C)cc3)c3c(ccc4ccccc34)O2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine?
The InChIKey is SBWDBOHSFHAECL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21NO2/c1-17-7-9-19(10-8-17)25-24-22-6-4-3-5-18(22)13-16-23(24)29-26(27-25)20-11-14-21(28-2)15-12-20/h3-16,25H,1-2H3.
What are the key properties of 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine?
3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine has a molecular weight of 379.46 g/mol, XLogP of 6.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1-(4-methylphenyl)-1H-benzo[f][1,3]benzoxazine is sourced from PubChem (CID 70695440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).