C35H44N6O — CID 70695732
3-methyl-2-(4-methylpiperazin-1-yl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinoline-4-carboxamide (PubChem CID 70695732) has the molecular formula C35H44N6O and a molecular weight of 564.78 g/mol. Its IUPAC name is 3-methyl-2-(4-methylpiperazin-1-yl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinoline-4-carboxamide.
| Compound Name | 3-methyl-2-(4-methylpiperazin-1-yl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70695732 |
| Molecular Formula | C35H44N6O |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | 3-methyl-2-(4-methylpiperazin-1-yl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]quinoline-4-carboxamide |
| SMILES | Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C35H44N6O/c1-25-32(26-13-5-8-16-29(26)39-34(25)41-23-21-40(2)22-24-41)35(42)37-20-12-4-3-11-19-36-33-27-14-6-9-17-30(27)38-31-18-10-7-15-28(31)33/h5-6,8-9,13-14,16-17H,3-4,7,10-12,15,18-24H2,1-2H3,(H,36,38)(H,37,42) |
| InChIKey | KDTJORYHBNCAEH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|