About 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol
4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol (PubChem CID 70695837) has the molecular formula C24H26O6
and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol.
Molecular Properties
| Compound Name | 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol |
| PubChem CID | 70695837 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol |
| SMILES | COCOc1c(OCOC)c(-c2ccc(O)cc2)c(C)c(C)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C24H26O6/c1-15-16(2)22(18-7-11-20(26)12-8-18)24(30-14-28-4)23(29-13-27-3)21(15)17-5-9-19(25)10-6-17/h5-12,25-26H,13-14H2,1-4H3 |
| InChIKey | HHJUVVJNRIBMAO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol?
The IUPAC name of 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol (CID 70695837) is 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol.
What is the SMILES notation for 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol?
The canonical SMILES for 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol is COCOc1c(OCOC)c(-c2ccc(O)cc2)c(C)c(C)c1-c1ccc(O)cc1.
What is the InChIKey of 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol?
The InChIKey is HHJUVVJNRIBMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O6/c1-15-16(2)22(18-7-11-20(26)12-8-18)24(30-14-28-4)23(29-13-27-3)21(15)17-5-9-19(25)10-6-17/h5-12,25-26H,13-14H2,1-4H3.
What are the key properties of 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol?
4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol has a molecular weight of 410.47 g/mol, XLogP of 5.01, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-hydroxyphenyl)-2,3-bis(methoxymethoxy)-5,6-dimethylphenyl]phenol is sourced from PubChem (CID 70695837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).