C28H23N5O4 — CID 70695889
7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-4-[2-(pyridine-2-carbonyl)anilino]quinoline-3-carboxamide (PubChem CID 70695889) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-4-[2-(pyridine-2-carbonyl)anilino]quinoline-3-carboxamide.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-4-[2-(pyridine-2-carbonyl)anilino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 70695889 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-4-[2-(pyridine-2-carbonyl)anilino]quinoline-3-carboxamide |
| SMILES | COc1cc2c(Nc3ccccc3C(=O)c3ccccn3)c(C(N)=O)cnc2cc1-c1c(C)noc1C |
| InChI | InChI=1S/C28H23N5O4/c1-15-25(16(2)37-33-15)19-12-23-18(13-24(19)36-3)26(20(14-31-23)28(29)35)32-21-9-5-4-8-17(21)27(34)22-10-6-7-11-30-22/h4-14H,1-3H3,(H2,29,35)(H,31,32) |
| InChIKey | BETHVCQFAJRUPN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 133.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|