C19H25NO5 — CID 70695943
(2S,3R,4R,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-1H-pyrrol-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70695943) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-1H-pyrrol-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-1H-pyrrol-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70695943 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-1H-pyrrol-3-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c[nH]2)cc1 |
| InChI | InChI=1S/C19H25NO5/c1-2-11-3-5-12(6-4-11)7-14-8-13(9-20-14)19-18(24)17(23)16(22)15(10-21)25-19/h3-6,8-9,15-24H,2,7,10H2,1H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | PQKMIFZGRFKWSJ-FQBWVUSXSA-N |
| XLogP | 0.68 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |