C24H29N7O5S — CID 70695988
(2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(1-benzothiophen-3-yl)ethyl]amino]butanoic acid (PubChem CID 70695988) has the molecular formula C24H29N7O5S and a molecular weight of 527.61 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(1-benzothiophen-3-yl)ethyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(1-benzothiophen-3-yl)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 70695988 |
| Molecular Formula | C24H29N7O5S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(1-benzothiophen-3-yl)ethyl]amino]butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CCc2csc3ccccc23)CC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H29N7O5S/c25-15(24(34)35)6-8-30(7-5-13-10-37-17-4-2-1-3-14(13)17)9-16-19(32)20(33)23(36-16)31-12-29-18-21(26)27-11-28-22(18)31/h1-4,10-12,15-16,19-20,23,32-33H,5-9,25H2,(H,34,35)(H2,26,27,28)/t15-,16+,19+,20+,23+/m0/s1 |
| InChIKey | FSMQALLDUCWVDV-PISIQOCNSA-N |
| XLogP | 0.59 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |