C17H19NO4 — CID 70696008
[(3R,3aR)-2-oxo-3-prop-2-enyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-4-yl] 2-phenylacetate (PubChem CID 70696008) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(3R,3aR)-2-oxo-3-prop-2-enyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-4-yl] 2-phenylacetate.
| Compound Name | [(3R,3aR)-2-oxo-3-prop-2-enyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-4-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 70696008 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [(3R,3aR)-2-oxo-3-prop-2-enyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-4-yl] 2-phenylacetate |
| SMILES | C=CC[C@H]1C(=O)OC2CCN(OC(=O)Cc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C17H19NO4/c1-2-6-13-16-14(21-17(13)20)9-10-18(16)22-15(19)11-12-7-4-3-5-8-12/h2-5,7-8,13-14,16H,1,6,9-11H2/t13-,14?,16-/m1/s1 |
| InChIKey | UADOQDIJISPEEU-XRZAVGITSA-N |
| XLogP | 1.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|