C26H32F2N6O5S — CID 70696265
[(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl] 2-methylpropyl carbonate (PubChem CID 70696265) has the molecular formula C26H32F2N6O5S and a molecular weight of 578.64 g/mol. Its IUPAC name is [(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl] 2-methylpropyl carbonate.
| Compound Name | [(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 70696265 |
| Molecular Formula | C26H32F2N6O5S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | [(1S,2S,3S,4R)-4-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl] 2-methylpropyl carbonate |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C[C@H](OC(=O)OCC(C)C)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C26H32F2N6O5S/c1-4-7-40-25-30-23(29-17-9-14(17)13-5-6-15(27)16(28)8-13)20-24(31-25)34(33-32-20)18-10-19(22(36)21(18)35)39-26(37)38-11-12(2)3/h5-6,8,12,14,17-19,21-22,35-36H,4,7,9-11H2,1-3H3,(H,29,30,31)/t14-,17+,18+,19-,21-,22+/m0/s1 |
| InChIKey | LBFGVOFBYKGNNL-FYEBJQQMSA-N |
| XLogP | 3.81 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |