C23H27N3O4 — CID 70696339
(2S)-2-[[4-amino-3-[2-(1H-indol-3-yl)ethoxy]benzoyl]amino]-4-methylpentanoic acid (PubChem CID 70696339) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (2S)-2-[[4-amino-3-[2-(1H-indol-3-yl)ethoxy]benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-amino-3-[2-(1H-indol-3-yl)ethoxy]benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70696339 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (2S)-2-[[4-amino-3-[2-(1H-indol-3-yl)ethoxy]benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(N)c(OCCc2c[nH]c3ccccc23)c1)C(=O)O |
| InChI | InChI=1S/C23H27N3O4/c1-14(2)11-20(23(28)29)26-22(27)15-7-8-18(24)21(12-15)30-10-9-16-13-25-19-6-4-3-5-17(16)19/h3-8,12-14,20,25H,9-11,24H2,1-2H3,(H,26,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | CHGBDQQPQMHXMF-FQEVSTJZSA-N |
| XLogP | 3.60 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|