C28H25FN2O — CID 70696356
4-(4-fluorophenyl)-N-[6-(pyrrolidin-1-ylmethyl)naphthalen-2-yl]benzamide (PubChem CID 70696356) has the molecular formula C28H25FN2O and a molecular weight of 424.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[6-(pyrrolidin-1-ylmethyl)naphthalen-2-yl]benzamide.
| Compound Name | 4-(4-fluorophenyl)-N-[6-(pyrrolidin-1-ylmethyl)naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 70696356 |
| Molecular Formula | C28H25FN2O |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[6-(pyrrolidin-1-ylmethyl)naphthalen-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2cc(CN3CCCC3)ccc2c1)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H25FN2O/c29-26-12-9-22(10-13-26)21-5-7-23(8-6-21)28(32)30-27-14-11-24-17-20(3-4-25(24)18-27)19-31-15-1-2-16-31/h3-14,17-18H,1-2,15-16,19H2,(H,30,32) |
| InChIKey | UUVLZGBRJNIVPH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |