C24H24O2S — CID 70696556
6-hex-1-ynyl-5-phenyl-4-oxa-8-thiatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 70696556) has the molecular formula C24H24O2S and a molecular weight of 376.52 g/mol. Its IUPAC name is 6-hex-1-ynyl-5-phenyl-4-oxa-8-thiatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 6-hex-1-ynyl-5-phenyl-4-oxa-8-thiatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 70696556 |
| Molecular Formula | C24H24O2S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 6-hex-1-ynyl-5-phenyl-4-oxa-8-thiatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | CCCCC#Cc1c(-c2ccccc2)oc(=O)c2c3c(sc12)CCCCC3 |
| InChI | InChI=1S/C24H24O2S/c1-2-3-4-9-15-19-22(17-12-7-5-8-13-17)26-24(25)21-18-14-10-6-11-16-20(18)27-23(19)21/h5,7-8,12-13H,2-4,6,10-11,14,16H2,1H3 |
| InChIKey | IYBUKTHCFIIOBM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|