C19H20N4O4S — CID 70696578
N-hydroxy-5-[4-(pent-4-enoylamino)benzoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 70696578) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-hydroxy-5-[4-(pent-4-enoylamino)benzoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-5-[4-(pent-4-enoylamino)benzoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70696578 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-hydroxy-5-[4-(pent-4-enoylamino)benzoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | C=CCCC(=O)Nc1ccc(C(=O)N2CCc3nc(C(=O)NO)sc3C2)cc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-2-3-4-16(24)20-13-7-5-12(6-8-13)19(26)23-10-9-14-15(11-23)28-18(21-14)17(25)22-27/h2,5-8,27H,1,3-4,9-11H2,(H,20,24)(H,22,25) |
| InChIKey | OWHBIYPVUQYBPR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|