C24H27FN2O7S — CID 70696615
(4-fluorophenyl)-[1-[(3R,4R)-3-hydroxy-1-(thiophene-2-carbonyl)piperidin-4-yl]piperidin-4-yl]methanone;oxalic acid (PubChem CID 70696615) has the molecular formula C24H27FN2O7S and a molecular weight of 506.55 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[(3R,4R)-3-hydroxy-1-(thiophene-2-carbonyl)piperidin-4-yl]piperidin-4-yl]methanone;oxalic acid.
| Compound Name | (4-fluorophenyl)-[1-[(3R,4R)-3-hydroxy-1-(thiophene-2-carbonyl)piperidin-4-yl]piperidin-4-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 70696615 |
| Molecular Formula | C24H27FN2O7S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4-fluorophenyl)-[1-[(3R,4R)-3-hydroxy-1-(thiophene-2-carbonyl)piperidin-4-yl]piperidin-4-yl]methanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1ccc(F)cc1)C1CCN([C@@H]2CCN(C(=O)c3cccs3)C[C@H]2O)CC1 |
| InChI | InChI=1S/C22H25FN2O3S.C2H2O4/c23-17-5-3-15(4-6-17)21(27)16-7-10-24(11-8-16)18-9-12-25(14-19(18)26)22(28)20-2-1-13-29-20;3-1(4)2(5)6/h1-6,13,16,18-19,26H,7-12,14H2;(H,3,4)(H,5,6)/t18-,19-;/m1./s1 |
| InChIKey | KJBRKAKQRIVFCD-STYNFMPRSA-N |
| XLogP | 2.21 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|