C15H15N3O6S — CID 70696645
[4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)phenyl] sulfamate (PubChem CID 70696645) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is [4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)phenyl] sulfamate.
| Compound Name | [4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)phenyl] sulfamate |
|---|---|
| PubChem CID | 70696645 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(NC(=O)Nc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C15H15N3O6S/c16-25(20,21)24-12-4-1-10(2-5-12)17-15(19)18-11-3-6-13-14(9-11)23-8-7-22-13/h1-6,9H,7-8H2,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | SNZSCSKYUIOHAI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |