C16H22O6 — CID 70696889
(1R,2E,8S,10R,11S)-8-hydroxy-6-(hydroxymethyl)-11-methoxy-1,10-dimethyl-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-5-one (PubChem CID 70696889) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1R,2E,8S,10R,11S)-8-hydroxy-6-(hydroxymethyl)-11-methoxy-1,10-dimethyl-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-5-one.
| Compound Name | (1R,2E,8S,10R,11S)-8-hydroxy-6-(hydroxymethyl)-11-methoxy-1,10-dimethyl-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-5-one |
|---|---|
| PubChem CID | 70696889 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (1R,2E,8S,10R,11S)-8-hydroxy-6-(hydroxymethyl)-11-methoxy-1,10-dimethyl-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-5-one |
| SMILES | CO[C@]12CC[C@](C)(/C=C3/OC(=O)C(CO)=C3[C@@H](O)C[C@H]1C)O2 |
| InChI | InChI=1S/C16H22O6/c1-9-6-11(18)13-10(8-17)14(19)21-12(13)7-15(2)4-5-16(9,20-3)22-15/h7,9,11,17-18H,4-6,8H2,1-3H3/b12-7+/t9-,11+,15-,16+/m1/s1 |
| InChIKey | VDFYFLJYQRIOKN-LQTQNCDASA-N |
| XLogP | 1.03 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |