C29H25FO2 — CID 70696949
ethyl 2-[(3E)-3-(9H-fluoren-2-ylmethylidene)-6-fluoroinden-1-yl]-2-methylpropanoate (PubChem CID 70696949) has the molecular formula C29H25FO2 and a molecular weight of 424.52 g/mol. Its IUPAC name is ethyl 2-[(3E)-3-(9H-fluoren-2-ylmethylidene)-6-fluoroinden-1-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(3E)-3-(9H-fluoren-2-ylmethylidene)-6-fluoroinden-1-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 70696949 |
| Molecular Formula | C29H25FO2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethyl 2-[(3E)-3-(9H-fluoren-2-ylmethylidene)-6-fluoroinden-1-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1=C/C(=C\c2ccc3c(c2)Cc2ccccc2-3)c2ccc(F)cc21 |
| InChI | InChI=1S/C29H25FO2/c1-4-32-28(31)29(2,3)27-16-21(25-12-10-22(30)17-26(25)27)14-18-9-11-24-20(13-18)15-19-7-5-6-8-23(19)24/h5-14,16-17H,4,15H2,1-3H3/b21-14+ |
| InChIKey | DUAVQDOWIHBMKL-KGENOOAVSA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|