C24H23NO4 — CID 70696981
(2S,3R,4S,5R)-2-[1-(naphthalen-2-ylmethyl)indol-3-yl]oxane-3,4,5-triol (PubChem CID 70696981) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[1-(naphthalen-2-ylmethyl)indol-3-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[1-(naphthalen-2-ylmethyl)indol-3-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70696981 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (2S,3R,4S,5R)-2-[1-(naphthalen-2-ylmethyl)indol-3-yl]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2cn(Cc3ccc4ccccc4c3)c3ccccc23)OC[C@H]1O |
| InChI | InChI=1S/C24H23NO4/c26-21-14-29-24(23(28)22(21)27)19-13-25(20-8-4-3-7-18(19)20)12-15-9-10-16-5-1-2-6-17(16)11-15/h1-11,13,21-24,26-28H,12,14H2/t21-,22+,23-,24+/m1/s1 |
| InChIKey | NLFQFWBEDCBEBR-QPXUXIHVSA-N |
| XLogP | 3.00 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |