C35H28O11 — CID 70696996
2-[2-(6-methoxynaphthalen-2-yl)propanoyloxy]ethyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 70696996) has the molecular formula C35H28O11 and a molecular weight of 624.60 g/mol. Its IUPAC name is 2-[2-(6-methoxynaphthalen-2-yl)propanoyloxy]ethyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-[2-(6-methoxynaphthalen-2-yl)propanoyloxy]ethyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 70696996 |
| Molecular Formula | C35H28O11 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 2-[2-(6-methoxynaphthalen-2-yl)propanoyloxy]ethyl 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COc1ccc2cc(C(C)C(=O)OCCOC(=O)c3cc(OC(C)=O)c4c(c3)C(=O)c3cccc(OC(C)=O)c3C4=O)ccc2c1 |
| InChI | InChI=1S/C35H28O11/c1-18(21-8-9-23-15-25(42-4)11-10-22(23)14-21)34(40)43-12-13-44-35(41)24-16-27-31(29(17-24)46-20(3)37)33(39)30-26(32(27)38)6-5-7-28(30)45-19(2)36/h5-11,14-18H,12-13H2,1-4H3 |
| InChIKey | IEZVUOGZKOJOLL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|