About 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate
2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 70696998) has the molecular formula C26H18O10
and a molecular weight of 490.42 g/mol. Its IUPAC name is 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 70696998 |
| Molecular Formula | C26H18O10 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCCOC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C26H18O10/c1-13(27)36-20-8-3-2-5-15(20)26(33)35-10-9-34-25(32)14-11-17-22(19(29)12-14)24(31)21-16(23(17)30)6-4-7-18(21)28/h2-8,11-12,28-29H,9-10H2,1H3 |
| InChIKey | UKANAFJRCUIXJU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate (CID 70696998) is 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate is CC(=O)Oc1ccccc1C(=O)OCCOC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is UKANAFJRCUIXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18O10/c1-13(27)36-20-8-3-2-5-15(20)26(33)35-10-9-34-25(32)14-11-17-22(19(29)12-14)24(31)21-16(23(17)30)6-4-7-18(21)28/h2-8,11-12,28-29H,9-10H2,1H3.
What are the key properties of 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 490.42 g/mol, XLogP of 2.81, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetyloxybenzoyl)oxyethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 70696998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).