C20H20F4N4O3 — CID 70697121
(3R)-3-amino-1-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70697121) has the molecular formula C20H20F4N4O3 and a molecular weight of 440.40 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70697121 |
| Molecular Formula | C20H20F4N4O3 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (3R)-3-amino-1-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2F)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H20F4N4O3/c21-15-11-17(23)16(22)8-12(15)7-13(25)9-20(29)27-5-3-26(4-6-27)19-2-1-14(28(30)31)10-18(19)24/h1-2,8,10-11,13H,3-7,9,25H2/t13-/m1/s1 |
| InChIKey | GNYSEVAVKFKYBS-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|