C32H40O5 — CID 70697135
benzyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-phenylmethoxy-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate (PubChem CID 70697135) has the molecular formula C32H40O5 and a molecular weight of 504.67 g/mol. Its IUPAC name is benzyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-phenylmethoxy-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate.
| Compound Name | benzyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-phenylmethoxy-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 70697135 |
| Molecular Formula | C32H40O5 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | benzyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-phenylmethoxy-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate |
| SMILES | COCOC[C@@]12C=C[C@@H](C(C)(C)C(=O)OCc3ccccc3)C[C@@H]1C=C(C)C[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C32H40O5/c1-24-17-28-19-27(31(2,3)30(33)37-21-26-13-9-6-10-14-26)15-16-32(28,22-35-23-34-4)29(18-24)36-20-25-11-7-5-8-12-25/h5-17,27-29H,18-23H2,1-4H3/t27-,28+,29+,32+/m1/s1 |
| InChIKey | QZDCDIHGMSSECD-QXPIXXMASA-N |
| XLogP | 6.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|