C26H40O5 — CID 70697136
2-methylprop-2-enyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-(2-methylprop-2-enoxy)-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate (PubChem CID 70697136) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-(2-methylprop-2-enoxy)-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate.
| Compound Name | 2-methylprop-2-enyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-(2-methylprop-2-enoxy)-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 70697136 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 2-methylprop-2-enyl 2-[(2S,4aR,5S,8aR)-4a-(methoxymethoxymethyl)-7-methyl-5-(2-methylprop-2-enoxy)-2,5,6,8a-tetrahydro-1H-naphthalen-2-yl]-2-methylpropanoate |
| SMILES | C=C(C)COC(=O)C(C)(C)[C@@H]1C=C[C@@]2(COCOC)[C@@H](OCC(=C)C)CC(C)=C[C@H]2C1 |
| InChI | InChI=1S/C26H40O5/c1-18(2)14-30-23-12-20(5)11-22-13-21(9-10-26(22,23)16-29-17-28-8)25(6,7)24(27)31-15-19(3)4/h9-11,21-23H,1,3,12-17H2,2,4-8H3/t21-,22+,23+,26+/m1/s1 |
| InChIKey | XGIYERIUBJGHDA-KSZLKVKMSA-N |
| XLogP | 5.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|