About 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine
3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 70697147) has the molecular formula C25H30N6O
and a molecular weight of 430.56 g/mol. Its IUPAC name is 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 70697147 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCN1CCC(n2nc(-c3ccc4cc(OCC)ccc4c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C25H30N6O/c1-3-11-30-12-9-20(10-13-30)31-25-22(24(26)27-16-28-25)23(29-31)19-6-5-18-15-21(32-4-2)8-7-17(18)14-19/h5-8,14-16,20H,3-4,9-13H2,1-2H3,(H2,26,27,28) |
| InChIKey | PPXYWUHAYDYRIY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine (CID 70697147) is 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine is CCCN1CCC(n2nc(-c3ccc4cc(OCC)ccc4c3)c3c(N)ncnc32)CC1.
What is the InChIKey of 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is PPXYWUHAYDYRIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N6O/c1-3-11-30-12-9-20(10-13-30)31-25-22(24(26)27-16-28-25)23(29-31)19-6-5-18-15-21(32-4-2)8-7-17(18)14-19/h5-8,14-16,20H,3-4,9-13H2,1-2H3,(H2,26,27,28).
What are the key properties of 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 430.56 g/mol, XLogP of 4.67, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-ethoxynaphthalen-2-yl)-1-(1-propylpiperidin-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 70697147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).