C34H67ClN10 — CID 70697170
6,19-dioctyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(26),11,14(28),24(27)-tetraene;hydrochloride (PubChem CID 70697170) has the molecular formula C34H67ClN10 and a molecular weight of 651.43 g/mol. Its IUPAC name is 6,19-dioctyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(26),11,14(28),24(27)-tetraene;hydrochloride.
| Compound Name | 6,19-dioctyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(26),11,14(28),24(27)-tetraene;hydrochloride |
|---|---|
| PubChem CID | 70697170 |
| Molecular Formula | C34H67ClN10 |
| Molecular Weight | 651.43 g/mol |
| Exact Mass | 650.52 |
| IUPAC Name | 6,19-dioctyl-3,6,9,12,13,16,19,22,25,26-decazatricyclo[22.2.1.111,14]octacosa-1(26),11,14(28),24(27)-tetraene;hydrochloride |
| SMILES | CCCCCCCCN1CCNCc2cc([nH]n2)CNCCN(CCCCCCCC)CCNCc2cc(n[nH]2)CNCC1.Cl |
| InChI | InChI=1S/C34H66N10.ClH/c1-3-5-7-9-11-13-19-43-21-15-35-27-31-25-33(41-39-31)29-37-17-23-44(20-14-12-10-8-6-4-2)24-18-38-30-34-26-32(40-42-34)28-36-16-22-43;/h25-26,35-38H,3-24,27-30H2,1-2H3,(H,39,41)(H,40,42);1H |
| InChIKey | CVMTVBQAKXQQPD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|