C25H28ClN5 — CID 70697305
N'-butyl-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-cyanopiperidine-1-carboximidamide (PubChem CID 70697305) has the molecular formula C25H28ClN5 and a molecular weight of 433.99 g/mol. Its IUPAC name is N'-butyl-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-cyanopiperidine-1-carboximidamide.
| Compound Name | N'-butyl-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-cyanopiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 70697305 |
| Molecular Formula | C25H28ClN5 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N'-butyl-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-cyanopiperidine-1-carboximidamide |
| SMILES | CCCC/N=C(\NC#N)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C25H28ClN5/c1-2-3-12-29-25(30-17-27)31-14-10-18(11-15-31)23-22-9-8-21(26)16-20(22)7-6-19-5-4-13-28-24(19)23/h4-5,8-9,13,16H,2-3,6-7,10-12,14-15H2,1H3,(H,29,30) |
| InChIKey | QKHPYQKSZJNAHL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|